C19H37N3O5 — CID 159171513
(2S)-N-[5-(hydroxymethyl)-6-methoxyhexyl]-2,5-bis(propanoylamino)pentanamide (PubChem CID 159171513) has the molecular formula C19H37N3O5 and a molecular weight of 387.52 g/mol. Its IUPAC name is (2S)-N-[5-(hydroxymethyl)-6-methoxyhexyl]-2,5-bis(propanoylamino)pentanamide.
| Compound Name | (2S)-N-[5-(hydroxymethyl)-6-methoxyhexyl]-2,5-bis(propanoylamino)pentanamide |
|---|---|
| PubChem CID | 159171513 |
| Molecular Formula | C19H37N3O5 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.27 |
| IUPAC Name | (2S)-N-[5-(hydroxymethyl)-6-methoxyhexyl]-2,5-bis(propanoylamino)pentanamide |
| SMILES | CCC(=O)NCCC[C@H](NC(=O)CC)C(=O)NCCCCC(CO)COC |
| InChI | InChI=1S/C19H37N3O5/c1-4-17(24)20-12-8-10-16(22-18(25)5-2)19(26)21-11-7-6-9-15(13-23)14-27-3/h15-16,23H,4-14H2,1-3H3,(H,20,24)(H,21,26)(H,22,25)/t15?,16-/m0/s1 |
| InChIKey | SOKMPCQPKFLIMC-LYKKTTPLSA-N |
| XLogP | 0.73 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|