C14H29NO6P- — CID 140808423
tert-butyl [2-(hydroxymethyl)-6-(propanoylamino)hexyl] phosphate (PubChem CID 140808423) has the molecular formula C14H29NO6P- and a molecular weight of 338.36 g/mol. Its IUPAC name is tert-butyl [2-(hydroxymethyl)-6-(propanoylamino)hexyl] phosphate.
| Compound Name | tert-butyl [2-(hydroxymethyl)-6-(propanoylamino)hexyl] phosphate |
|---|---|
| PubChem CID | 140808423 |
| Molecular Formula | C14H29NO6P- |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | tert-butyl [2-(hydroxymethyl)-6-(propanoylamino)hexyl] phosphate |
| SMILES | CCC(=O)NCCCCC(CO)COP(=O)([O-])OC(C)(C)C |
| InChI | InChI=1S/C14H30NO6P/c1-5-13(17)15-9-7-6-8-12(10-16)11-20-22(18,19)21-14(2,3)4/h12,16H,5-11H2,1-4H3,(H,15,17)(H,18,19)/p-1 |
| InChIKey | GCNRITIJLBRXBF-UHFFFAOYSA-M |
| XLogP | 1.59 |
| TPSA | 107.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|