C12H25NO7P- — CID 158515585
tert-butyl [2-hydroxy-3-[2-(propanoylamino)ethoxy]propyl] phosphate (PubChem CID 158515585) has the molecular formula C12H25NO7P- and a molecular weight of 326.31 g/mol. Its IUPAC name is tert-butyl [2-hydroxy-3-[2-(propanoylamino)ethoxy]propyl] phosphate.
| Compound Name | tert-butyl [2-hydroxy-3-[2-(propanoylamino)ethoxy]propyl] phosphate |
|---|---|
| PubChem CID | 158515585 |
| Molecular Formula | C12H25NO7P- |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | tert-butyl [2-hydroxy-3-[2-(propanoylamino)ethoxy]propyl] phosphate |
| SMILES | CCC(=O)NCCOCC(O)COP(=O)([O-])OC(C)(C)C |
| InChI | InChI=1S/C12H26NO7P/c1-5-11(15)13-6-7-18-8-10(14)9-19-21(16,17)20-12(2,3)4/h10,14H,5-9H2,1-4H3,(H,13,15)(H,16,17)/p-1 |
| InChIKey | HLOWMKSKOYATMY-UHFFFAOYSA-M |
| XLogP | 0.19 |
| TPSA | 117.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|