C23H44NO8P — CID 165189945
[2-hydroxy-3-[hydroxy-[2-(propanoylamino)ethoxy]phosphoryl]oxypropyl] (Z)-pentadec-9-enoate (PubChem CID 165189945) has the molecular formula C23H44NO8P and a molecular weight of 493.58 g/mol. Its IUPAC name is [2-hydroxy-3-[hydroxy-[2-(propanoylamino)ethoxy]phosphoryl]oxypropyl] (Z)-pentadec-9-enoate.
| Compound Name | [2-hydroxy-3-[hydroxy-[2-(propanoylamino)ethoxy]phosphoryl]oxypropyl] (Z)-pentadec-9-enoate |
|---|---|
| PubChem CID | 165189945 |
| Molecular Formula | C23H44NO8P |
| Molecular Weight | 493.58 g/mol |
| Exact Mass | 493.28 |
| IUPAC Name | [2-hydroxy-3-[hydroxy-[2-(propanoylamino)ethoxy]phosphoryl]oxypropyl] (Z)-pentadec-9-enoate |
| SMILES | CCCCC/C=C\CCCCCCCC(=O)OCC(O)COP(=O)(O)OCCNC(=O)CC |
| InChI | InChI=1S/C23H44NO8P/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-23(27)30-19-21(25)20-32-33(28,29)31-18-17-24-22(26)4-2/h8-9,21,25H,3-7,10-20H2,1-2H3,(H,24,26)(H,28,29)/b9-8- |
| InChIKey | BKOHORBOKDLMJE-HJWRWDBZSA-N |
| XLogP | 4.42 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.58 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|