C27H52NO8P — CID 165266731
[3-[2-(hexanoylamino)ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (Z)-hexadec-9-enoate (PubChem CID 165266731) has the molecular formula C27H52NO8P and a molecular weight of 549.69 g/mol. Its IUPAC name is [3-[2-(hexanoylamino)ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (Z)-hexadec-9-enoate.
| Compound Name | [3-[2-(hexanoylamino)ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (Z)-hexadec-9-enoate |
|---|---|
| PubChem CID | 165266731 |
| Molecular Formula | C27H52NO8P |
| Molecular Weight | 549.69 g/mol |
| Exact Mass | 549.34 |
| IUPAC Name | [3-[2-(hexanoylamino)ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (Z)-hexadec-9-enoate |
| SMILES | CCCCCC/C=C\CCCCCCCC(=O)OCC(O)COP(=O)(O)OCCNC(=O)CCCCC |
| InChI | InChI=1S/C27H52NO8P/c1-3-5-7-8-9-10-11-12-13-14-15-16-18-20-27(31)34-23-25(29)24-36-37(32,33)35-22-21-28-26(30)19-17-6-4-2/h10-11,25,29H,3-9,12-24H2,1-2H3,(H,28,30)(H,32,33)/b11-10- |
| InChIKey | ODZXGEUUZVYFHH-KHPPLWFESA-N |
| XLogP | 5.98 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.69 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|