C38H72NO8P — CID 165309314
[2-hydroxy-3-[hydroxy-[2-[[(Z)-pentadec-9-enoyl]amino]ethoxy]phosphoryl]oxypropyl] (Z)-octadec-9-enoate (PubChem CID 165309314) has the molecular formula C38H72NO8P and a molecular weight of 701.97 g/mol. Its IUPAC name is [2-hydroxy-3-[hydroxy-[2-[[(Z)-pentadec-9-enoyl]amino]ethoxy]phosphoryl]oxypropyl] (Z)-octadec-9-enoate.
| Compound Name | [2-hydroxy-3-[hydroxy-[2-[[(Z)-pentadec-9-enoyl]amino]ethoxy]phosphoryl]oxypropyl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 165309314 |
| Molecular Formula | C38H72NO8P |
| Molecular Weight | 701.97 g/mol |
| Exact Mass | 701.50 |
| IUPAC Name | [2-hydroxy-3-[hydroxy-[2-[[(Z)-pentadec-9-enoyl]amino]ethoxy]phosphoryl]oxypropyl] (Z)-octadec-9-enoate |
| SMILES | CCCCC/C=C\CCCCCCCC(=O)NCCOP(=O)(O)OCC(O)COC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C38H72NO8P/c1-3-5-7-9-11-13-15-17-18-19-21-23-25-27-29-31-38(42)45-34-36(40)35-47-48(43,44)46-33-32-39-37(41)30-28-26-24-22-20-16-14-12-10-8-6-4-2/h12,14,17-18,36,40H,3-11,13,15-16,19-35H2,1-2H3,(H,39,41)(H,43,44)/b14-12-,18-17- |
| InChIKey | VKHXTQGRHYRZIP-XZXDJJJYSA-N |
| XLogP | 10.05 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.97 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|