C40H76NO8P — CID 165252283
[2-hydroxy-3-[hydroxy-[2-[[(Z)-octadec-9-enoyl]amino]ethoxy]phosphoryl]oxypropyl] (Z)-heptadec-9-enoate (PubChem CID 165252283) has the molecular formula C40H76NO8P and a molecular weight of 730.02 g/mol. Its IUPAC name is [2-hydroxy-3-[hydroxy-[2-[[(Z)-octadec-9-enoyl]amino]ethoxy]phosphoryl]oxypropyl] (Z)-heptadec-9-enoate.
| Compound Name | [2-hydroxy-3-[hydroxy-[2-[[(Z)-octadec-9-enoyl]amino]ethoxy]phosphoryl]oxypropyl] (Z)-heptadec-9-enoate |
|---|---|
| PubChem CID | 165252283 |
| Molecular Formula | C40H76NO8P |
| Molecular Weight | 730.02 g/mol |
| Exact Mass | 729.53 |
| IUPAC Name | [2-hydroxy-3-[hydroxy-[2-[[(Z)-octadec-9-enoyl]amino]ethoxy]phosphoryl]oxypropyl] (Z)-heptadec-9-enoate |
| SMILES | CCCCCCC/C=C\CCCCCCCC(=O)OCC(O)COP(=O)(O)OCCNC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C40H76NO8P/c1-3-5-7-9-11-13-15-17-19-20-22-24-26-28-30-32-39(43)41-34-35-48-50(45,46)49-37-38(42)36-47-40(44)33-31-29-27-25-23-21-18-16-14-12-10-8-6-4-2/h16-19,38,42H,3-15,20-37H2,1-2H3,(H,41,43)(H,45,46)/b18-16-,19-17- |
| InChIKey | LYRIQCDETNRXFO-YGGBKCGDSA-N |
| XLogP | 10.83 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.02 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|