C26H50NO8P — CID 165258117
[3-[2-(hexanoylamino)ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (Z)-pentadec-9-enoate (PubChem CID 165258117) has the molecular formula C26H50NO8P and a molecular weight of 535.66 g/mol. Its IUPAC name is [3-[2-(hexanoylamino)ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (Z)-pentadec-9-enoate.
| Compound Name | [3-[2-(hexanoylamino)ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (Z)-pentadec-9-enoate |
|---|---|
| PubChem CID | 165258117 |
| Molecular Formula | C26H50NO8P |
| Molecular Weight | 535.66 g/mol |
| Exact Mass | 535.33 |
| IUPAC Name | [3-[2-(hexanoylamino)ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] (Z)-pentadec-9-enoate |
| SMILES | CCCCC/C=C\CCCCCCCC(=O)OCC(O)COP(=O)(O)OCCNC(=O)CCCCC |
| InChI | InChI=1S/C26H50NO8P/c1-3-5-7-8-9-10-11-12-13-14-15-17-19-26(30)33-22-24(28)23-35-36(31,32)34-21-20-27-25(29)18-16-6-4-2/h9-10,24,28H,3-8,11-23H2,1-2H3,(H,27,29)(H,31,32)/b10-9- |
| InChIKey | MWCTWQUXCJVTAN-KTKRTIGZSA-N |
| XLogP | 5.59 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.66 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|