C10H21NO9P- — CID 23592377
2,3-dihydroxypropyl 2-[(2-methylpropan-2-yl)oxycarbonyloxyamino]ethyl phosphate (PubChem CID 23592377) has the molecular formula C10H21NO9P- and a molecular weight of 330.25 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 2-[(2-methylpropan-2-yl)oxycarbonyloxyamino]ethyl phosphate.
| Compound Name | 2,3-dihydroxypropyl 2-[(2-methylpropan-2-yl)oxycarbonyloxyamino]ethyl phosphate |
|---|---|
| PubChem CID | 23592377 |
| Molecular Formula | C10H21NO9P- |
| Molecular Weight | 330.25 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 2,3-dihydroxypropyl 2-[(2-methylpropan-2-yl)oxycarbonyloxyamino]ethyl phosphate |
| SMILES | CC(C)(C)OC(=O)ONCCOP(=O)([O-])OCC(O)CO |
| InChI | InChI=1S/C10H22NO9P/c1-10(2,3)19-9(14)20-11-4-5-17-21(15,16)18-7-8(13)6-12/h8,11-13H,4-7H2,1-3H3,(H,15,16)/p-1 |
| InChIKey | JCSQTZGVCQPWON-UHFFFAOYSA-M |
| XLogP | -0.70 |
| TPSA | 146.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.25 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|