C13H25O8P — CID 87133675
[2,3-dihydroxypropoxy(2,2-dimethylpropanoyloxy)phosphoryl] 2,2-dimethylpropanoate (PubChem CID 87133675) has the molecular formula C13H25O8P and a molecular weight of 340.31 g/mol. Its IUPAC name is [2,3-dihydroxypropoxy(2,2-dimethylpropanoyloxy)phosphoryl] 2,2-dimethylpropanoate.
| Compound Name | [2,3-dihydroxypropoxy(2,2-dimethylpropanoyloxy)phosphoryl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 87133675 |
| Molecular Formula | C13H25O8P |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | [2,3-dihydroxypropoxy(2,2-dimethylpropanoyloxy)phosphoryl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OP(=O)(OCC(O)CO)OC(=O)C(C)(C)C |
| InChI | InChI=1S/C13H25O8P/c1-12(2,3)10(16)20-22(18,19-8-9(15)7-14)21-11(17)13(4,5)6/h9,14-15H,7-8H2,1-6H3 |
| InChIKey | CCLBWRLIPQBRES-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|