C3H7Na2O6P — CID 73416363
disodium;[(2R)-2,3-dihydroxypropyl] phosphate (PubChem CID 73416363) has the molecular formula C3H7Na2O6P and a molecular weight of 216.04 g/mol. Its IUPAC name is disodium;[(2R)-2,3-dihydroxypropyl] phosphate.
| Compound Name | disodium;[(2R)-2,3-dihydroxypropyl] phosphate |
|---|---|
| PubChem CID | 73416363 |
| Molecular Formula | C3H7Na2O6P |
| Molecular Weight | 216.04 g/mol |
| Exact Mass | 215.98 |
| IUPAC Name | disodium;[(2R)-2,3-dihydroxypropyl] phosphate |
| SMILES | O=P([O-])([O-])OC[C@H](O)CO.[Na+].[Na+] |
| InChI | InChI=1S/C3H9O6P.2Na/c4-1-3(5)2-9-10(6,7)8;;/h3-5H,1-2H2,(H2,6,7,8);;/q;2*+1/p-2/t3-;;/m1../s1 |
| InChIKey | GEKBIENFFVFKRG-HWYNEVGZSA-L |
| XLogP | -8.81 |
| TPSA | 112.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.04 |
| LogP ≤ 5 | -8.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|