C6H13BaO9P — CID 117072657
barium(2+);[(2S,3S,4S,5S)-2,3,4,5,6-pentahydroxyhexyl] phosphate (PubChem CID 117072657) has the molecular formula C6H13BaO9P and a molecular weight of 397.46 g/mol. Its IUPAC name is barium(2+);[(2S,3S,4S,5S)-2,3,4,5,6-pentahydroxyhexyl] phosphate.
| Compound Name | barium(2+);[(2S,3S,4S,5S)-2,3,4,5,6-pentahydroxyhexyl] phosphate |
|---|---|
| PubChem CID | 117072657 |
| Molecular Formula | C6H13BaO9P |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.93 |
| IUPAC Name | barium(2+);[(2S,3S,4S,5S)-2,3,4,5,6-pentahydroxyhexyl] phosphate |
| SMILES | O=P([O-])([O-])OC[C@H](O)[C@H](O)[C@@H](O)[C@@H](O)CO.[Ba+2] |
| InChI | InChI=1S/C6H15O9P.Ba/c7-1-3(8)5(10)6(11)4(9)2-15-16(12,13)14;/h3-11H,1-2H2,(H2,12,13,14);/q;+2/p-2/t3-,4-,5-,6-;/m0./s1 |
| InChIKey | ANEIDNTXSPRLJW-DEZHIRTDSA-L |
| XLogP | -5.11 |
| TPSA | 173.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | -5.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|