C6H10O9P-3 — CID 21130360
3,4,5-trihydroxy-6-phosphonatooxyhexanoate (PubChem CID 21130360) has the molecular formula C6H10O9P-3 and a molecular weight of 257.11 g/mol. Its IUPAC name is 3,4,5-trihydroxy-6-phosphonatooxyhexanoate.
| Compound Name | 3,4,5-trihydroxy-6-phosphonatooxyhexanoate |
|---|---|
| PubChem CID | 21130360 |
| Molecular Formula | C6H10O9P-3 |
| Molecular Weight | 257.11 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | 3,4,5-trihydroxy-6-phosphonatooxyhexanoate |
| SMILES | O=C([O-])CC(O)C(O)C(O)COP(=O)([O-])[O-] |
| InChI | InChI=1S/C6H13O9P/c7-3(1-5(9)10)6(11)4(8)2-15-16(12,13)14/h3-4,6-8,11H,1-2H2,(H,9,10)(H2,12,13,14)/p-3 |
| InChIKey | LTHDIZOWAIGONP-UHFFFAOYSA-K |
| XLogP | -4.95 |
| TPSA | 173.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.11 |
| LogP ≤ 5 | -4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|