C4H8NNa2O7P — CID 59142123
disodium;[(2R,3S)-4-amino-2,3-dihydroxy-4-oxobutyl] phosphate (PubChem CID 59142123) has the molecular formula C4H8NNa2O7P and a molecular weight of 259.06 g/mol. Its IUPAC name is disodium;[(2R,3S)-4-amino-2,3-dihydroxy-4-oxobutyl] phosphate.
| Compound Name | disodium;[(2R,3S)-4-amino-2,3-dihydroxy-4-oxobutyl] phosphate |
|---|---|
| PubChem CID | 59142123 |
| Molecular Formula | C4H8NNa2O7P |
| Molecular Weight | 259.06 g/mol |
| Exact Mass | 258.98 |
| IUPAC Name | disodium;[(2R,3S)-4-amino-2,3-dihydroxy-4-oxobutyl] phosphate |
| SMILES | NC(=O)[C@@H](O)[C@H](O)COP(=O)([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C4H10NO7P.2Na/c5-4(8)3(7)2(6)1-12-13(9,10)11;;/h2-3,6-7H,1H2,(H2,5,8)(H2,9,10,11);;/q;2*+1/p-2/t2-,3+;;/m1../s1 |
| InChIKey | ALLTTZZLAGGTLI-OTUWWBTESA-L |
| XLogP | -9.95 |
| TPSA | 155.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.06 |
| LogP ≤ 5 | -9.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|