C7H10O10P-3 — CID 5460215
(4R,5S,6R)-4,5,6-trihydroxy-2-oxo-7-phosphonatooxyheptanoate (PubChem CID 5460215) has the molecular formula C7H10O10P-3 and a molecular weight of 285.12 g/mol. Its IUPAC name is (4R,5S,6R)-4,5,6-trihydroxy-2-oxo-7-phosphonatooxyheptanoate.
| Compound Name | (4R,5S,6R)-4,5,6-trihydroxy-2-oxo-7-phosphonatooxyheptanoate |
|---|---|
| PubChem CID | 5460215 |
| Molecular Formula | C7H10O10P-3 |
| Molecular Weight | 285.12 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | (4R,5S,6R)-4,5,6-trihydroxy-2-oxo-7-phosphonatooxyheptanoate |
| SMILES | O=C([O-])C(=O)C[C@@H](O)[C@H](O)[C@H](O)COP(=O)([O-])[O-] |
| InChI | InChI=1S/C7H13O10P/c8-3(1-4(9)7(12)13)6(11)5(10)2-17-18(14,15)16/h3,5-6,8,10-11H,1-2H2,(H,12,13)(H2,14,15,16)/p-3/t3-,5-,6+/m1/s1 |
| InChIKey | PJWIPEXIFFQAQZ-PUFIMZNGSA-K |
| XLogP | -5.38 |
| TPSA | 190.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.12 |
| LogP ≤ 5 | -5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|