C6H13O9P-2 — CID 23421203
[(2S,3R,4R,5R)-1,2,4,5,6-pentahydroxyhexan-3-yl] phosphate (PubChem CID 23421203) has the molecular formula C6H13O9P-2 and a molecular weight of 260.13 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-1,2,4,5,6-pentahydroxyhexan-3-yl] phosphate.
| Compound Name | [(2S,3R,4R,5R)-1,2,4,5,6-pentahydroxyhexan-3-yl] phosphate |
|---|---|
| PubChem CID | 23421203 |
| Molecular Formula | C6H13O9P-2 |
| Molecular Weight | 260.13 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | [(2S,3R,4R,5R)-1,2,4,5,6-pentahydroxyhexan-3-yl] phosphate |
| SMILES | O=P([O-])([O-])O[C@@H]([C@H](O)[C@H](O)CO)[C@@H](O)CO |
| InChI | InChI=1S/C6H15O9P/c7-1-3(9)5(11)6(4(10)2-8)15-16(12,13)14/h3-11H,1-2H2,(H2,12,13,14)/p-2/t3-,4+,5-,6-/m1/s1 |
| InChIKey | RSCVCIHYYQHRMQ-JGWLITMVSA-L |
| XLogP | -4.73 |
| TPSA | 173.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.13 |
| LogP ≤ 5 | -4.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|