C12H24O19P2 — CID 87961850
[hydroxy-[(2R,3R,4R,5R)-1,2,4,5-tetrahydroxy-6-oxo-6-phosphonooxyhexan-3-yl]oxyphosphoryl] (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate (PubChem CID 87961850) has the molecular formula C12H24O19P2 and a molecular weight of 534.25 g/mol. Its IUPAC name is [hydroxy-[(2R,3R,4R,5R)-1,2,4,5-tetrahydroxy-6-oxo-6-phosphonooxyhexan-3-yl]oxyphosphoryl] (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate.
| Compound Name | [hydroxy-[(2R,3R,4R,5R)-1,2,4,5-tetrahydroxy-6-oxo-6-phosphonooxyhexan-3-yl]oxyphosphoryl] (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
|---|---|
| PubChem CID | 87961850 |
| Molecular Formula | C12H24O19P2 |
| Molecular Weight | 534.25 g/mol |
| Exact Mass | 534.04 |
| IUPAC Name | [hydroxy-[(2R,3R,4R,5R)-1,2,4,5-tetrahydroxy-6-oxo-6-phosphonooxyhexan-3-yl]oxyphosphoryl] (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
| SMILES | O=C(OP(=O)(O)O[C@@H]([C@H](O)[C@@H](O)C(=O)OP(=O)(O)O)[C@H](O)CO)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C12H24O19P2/c13-1-3(15)5(17)6(18)8(20)12(23)31-33(27,28)29-10(4(16)2-14)7(19)9(21)11(22)30-32(24,25)26/h3-10,13-21H,1-2H2,(H,27,28)(H2,24,25,26)/t3-,4-,5-,6+,7-,8-,9-,10-/m1/s1 |
| InChIKey | PJKJMJWYJLBSSW-GKYTZBSQSA-N |
| XLogP | -6.84 |
| TPSA | 338.73 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.25 |
| LogP ≤ 5 | -6.84 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|