C12H24O19P2 — CID 87521416
[[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]oxy-phosphonooxyphosphoryl] (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate (PubChem CID 87521416) has the molecular formula C12H24O19P2 and a molecular weight of 534.25 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]oxy-phosphonooxyphosphoryl] (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate.
| Compound Name | [[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]oxy-phosphonooxyphosphoryl] (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
|---|---|
| PubChem CID | 87521416 |
| Molecular Formula | C12H24O19P2 |
| Molecular Weight | 534.25 g/mol |
| Exact Mass | 534.04 |
| IUPAC Name | [[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]oxy-phosphonooxyphosphoryl] (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
| SMILES | O=C(OP(=O)(OC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)OP(=O)(O)O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C12H24O19P2/c13-1-3(15)5(17)7(19)9(21)11(23)29-33(28,31-32(25,26)27)30-12(24)10(22)8(20)6(18)4(16)2-14/h3-10,13-22H,1-2H2,(H2,25,26,27)/t3-,4-,5-,6-,7+,8+,9-,10-/m1/s1 |
| InChIKey | XCFVUTBVBLASOT-VCGUZZPXSA-N |
| XLogP | -6.84 |
| TPSA | 338.73 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.25 |
| LogP ≤ 5 | -6.84 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|