C8H17O12P — CID 57055187
(1,3,4,5,6,7,8-heptahydroxy-2-oxooctyl) dihydrogen phosphate (PubChem CID 57055187) has the molecular formula C8H17O12P and a molecular weight of 336.19 g/mol. Its IUPAC name is (1,3,4,5,6,7,8-heptahydroxy-2-oxooctyl) dihydrogen phosphate.
| Compound Name | (1,3,4,5,6,7,8-heptahydroxy-2-oxooctyl) dihydrogen phosphate |
|---|---|
| PubChem CID | 57055187 |
| Molecular Formula | C8H17O12P |
| Molecular Weight | 336.19 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | (1,3,4,5,6,7,8-heptahydroxy-2-oxooctyl) dihydrogen phosphate |
| SMILES | O=C(C(O)OP(=O)(O)O)C(O)C(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C8H17O12P/c9-1-2(10)3(11)4(12)5(13)6(14)7(15)8(16)20-21(17,18)19/h2-6,8-14,16H,1H2,(H2,17,18,19) |
| InChIKey | CARRHDBOOKJWKK-UHFFFAOYSA-N |
| XLogP | -5.22 |
| TPSA | 225.44 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.19 |
| LogP ≤ 5 | -5.22 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|