C6H12N3O10P — CID 123610918
[(3S,4S,5S)-6-azido-1,3,4,5,6-pentahydroxy-2-oxohexyl] dihydrogen phosphate (PubChem CID 123610918) has the molecular formula C6H12N3O10P and a molecular weight of 317.15 g/mol. Its IUPAC name is [(3S,4S,5S)-6-azido-1,3,4,5,6-pentahydroxy-2-oxohexyl] dihydrogen phosphate.
| Compound Name | [(3S,4S,5S)-6-azido-1,3,4,5,6-pentahydroxy-2-oxohexyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 123610918 |
| Molecular Formula | C6H12N3O10P |
| Molecular Weight | 317.15 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | [(3S,4S,5S)-6-azido-1,3,4,5,6-pentahydroxy-2-oxohexyl] dihydrogen phosphate |
| SMILES | [N-]=[N+]=NC(O)[C@@H](O)[C@H](O)[C@H](O)C(=O)C(O)OP(=O)(O)O |
| InChI | InChI=1S/C6H12N3O10P/c7-9-8-5(14)3(12)1(10)2(11)4(13)6(15)19-20(16,17)18/h1-3,5-6,10-12,14-15H,(H2,16,17,18)/t1-,2+,3+,5?,6?/m1/s1 |
| InChIKey | JSBYMQXZPJOSHF-QZBWFQCTSA-N |
| XLogP | -3.31 |
| TPSA | 233.74 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.15 |
| LogP ≤ 5 | -3.31 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|