C27H23N3O9 — CID 174641728
[(2R,3S,4R,5S)-6-azido-3,4-dibenzoyloxy-5,6-dihydroxy-1-oxohexan-2-yl] benzoate (PubChem CID 174641728) has the molecular formula C27H23N3O9 and a molecular weight of 533.49 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-6-azido-3,4-dibenzoyloxy-5,6-dihydroxy-1-oxohexan-2-yl] benzoate.
| Compound Name | [(2R,3S,4R,5S)-6-azido-3,4-dibenzoyloxy-5,6-dihydroxy-1-oxohexan-2-yl] benzoate |
|---|---|
| PubChem CID | 174641728 |
| Molecular Formula | C27H23N3O9 |
| Molecular Weight | 533.49 g/mol |
| Exact Mass | 533.14 |
| IUPAC Name | [(2R,3S,4R,5S)-6-azido-3,4-dibenzoyloxy-5,6-dihydroxy-1-oxohexan-2-yl] benzoate |
| SMILES | [N-]=[N+]=NC(O)[C@@H](O)[C@@H](OC(=O)c1ccccc1)[C@H](OC(=O)c1ccccc1)[C@H](C=O)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H23N3O9/c28-30-29-24(33)21(32)23(39-27(36)19-14-8-3-9-15-19)22(38-26(35)18-12-6-2-7-13-18)20(16-31)37-25(34)17-10-4-1-5-11-17/h1-16,20-24,32-33H/t20-,21-,22+,23+,24?/m0/s1 |
| InChIKey | VHLFCKWXKHDTNS-NNKIWQPVSA-N |
| XLogP | 2.85 |
| TPSA | 185.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.49 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|