C36H34O9S — CID 175332056
[(2R,3R,4S,5R)-3,5-dibenzoyloxy-2-hydroxy-6-oxo-4-(3-phenyl-2-sulfanylpropoxy)hexyl] benzoate (PubChem CID 175332056) has the molecular formula C36H34O9S and a molecular weight of 642.73 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3,5-dibenzoyloxy-2-hydroxy-6-oxo-4-(3-phenyl-2-sulfanylpropoxy)hexyl] benzoate.
| Compound Name | [(2R,3R,4S,5R)-3,5-dibenzoyloxy-2-hydroxy-6-oxo-4-(3-phenyl-2-sulfanylpropoxy)hexyl] benzoate |
|---|---|
| PubChem CID | 175332056 |
| Molecular Formula | C36H34O9S |
| Molecular Weight | 642.73 g/mol |
| Exact Mass | 642.19 |
| IUPAC Name | [(2R,3R,4S,5R)-3,5-dibenzoyloxy-2-hydroxy-6-oxo-4-(3-phenyl-2-sulfanylpropoxy)hexyl] benzoate |
| SMILES | O=C[C@H](OC(=O)c1ccccc1)[C@@H](OCC(S)Cc1ccccc1)[C@H](OC(=O)c1ccccc1)[C@H](O)COC(=O)c1ccccc1 |
| InChI | InChI=1S/C36H34O9S/c37-22-31(44-35(40)27-17-9-3-10-18-27)33(42-23-29(46)21-25-13-5-1-6-14-25)32(45-36(41)28-19-11-4-12-20-28)30(38)24-43-34(39)26-15-7-2-8-16-26/h1-20,22,29-33,38,46H,21,23-24H2/t29?,30-,31+,32-,33-/m1/s1 |
| InChIKey | DEANEPVUBPGCTL-JSDVJCTHSA-N |
| XLogP | 4.78 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.73 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|