C26H22O8 — CID 20599066
[(2R,3R,4R)-3,4-dibenzoyloxy-2-hydroxy-5-oxopentyl] benzoate (PubChem CID 20599066) has the molecular formula C26H22O8 and a molecular weight of 462.45 g/mol. Its IUPAC name is [(2R,3R,4R)-3,4-dibenzoyloxy-2-hydroxy-5-oxopentyl] benzoate.
| Compound Name | [(2R,3R,4R)-3,4-dibenzoyloxy-2-hydroxy-5-oxopentyl] benzoate |
|---|---|
| PubChem CID | 20599066 |
| Molecular Formula | C26H22O8 |
| Molecular Weight | 462.45 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | [(2R,3R,4R)-3,4-dibenzoyloxy-2-hydroxy-5-oxopentyl] benzoate |
| SMILES | O=C[C@H](OC(=O)c1ccccc1)[C@H](OC(=O)c1ccccc1)[C@H](O)COC(=O)c1ccccc1 |
| InChI | InChI=1S/C26H22O8/c27-16-22(33-25(30)19-12-6-2-7-13-19)23(34-26(31)20-14-8-3-9-15-20)21(28)17-32-24(29)18-10-4-1-5-11-18/h1-16,21-23,28H,17H2/t21-,22+,23-/m1/s1 |
| InChIKey | SJWXZGGHDTWCMU-XPWALMASSA-N |
| XLogP | 2.85 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|