C45H36O10S — CID 118337747
[(2S,3R,4R)-2-methylsulfonyloxy-5-oxo-3,4-bis[(4-phenylbenzoyl)oxy]pentyl] 4-phenylbenzoate (PubChem CID 118337747) has the molecular formula C45H36O10S and a molecular weight of 768.84 g/mol. Its IUPAC name is [(2S,3R,4R)-2-methylsulfonyloxy-5-oxo-3,4-bis[(4-phenylbenzoyl)oxy]pentyl] 4-phenylbenzoate.
| Compound Name | [(2S,3R,4R)-2-methylsulfonyloxy-5-oxo-3,4-bis[(4-phenylbenzoyl)oxy]pentyl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 118337747 |
| Molecular Formula | C45H36O10S |
| Molecular Weight | 768.84 g/mol |
| Exact Mass | 768.20 |
| IUPAC Name | [(2S,3R,4R)-2-methylsulfonyloxy-5-oxo-3,4-bis[(4-phenylbenzoyl)oxy]pentyl] 4-phenylbenzoate |
| SMILES | CS(=O)(=O)O[C@@H](COC(=O)c1ccc(-c2ccccc2)cc1)[C@H](OC(=O)c1ccc(-c2ccccc2)cc1)[C@H](C=O)OC(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C45H36O10S/c1-56(50,51)55-41(30-52-43(47)37-23-17-34(18-24-37)31-11-5-2-6-12-31)42(54-45(49)39-27-21-36(22-28-39)33-15-9-4-10-16-33)40(29-46)53-44(48)38-25-19-35(20-26-38)32-13-7-3-8-14-32/h2-29,40-42H,30H2,1H3/t40-,41-,42+/m0/s1 |
| InChIKey | DQBHGQCLICYAIU-WTQYMLSTSA-N |
| XLogP | 7.84 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.84 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|