C18H18O4 — CID 134233326
[(2S)-2-hydroxy-5-oxopentyl] 4-phenylbenzoate (PubChem CID 134233326) has the molecular formula C18H18O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is [(2S)-2-hydroxy-5-oxopentyl] 4-phenylbenzoate.
| Compound Name | [(2S)-2-hydroxy-5-oxopentyl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 134233326 |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | [(2S)-2-hydroxy-5-oxopentyl] 4-phenylbenzoate |
| SMILES | O=CCC[C@H](O)COC(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C18H18O4/c19-12-4-7-17(20)13-22-18(21)16-10-8-15(9-11-16)14-5-2-1-3-6-14/h1-3,5-6,8-12,17,20H,4,7,13H2/t17-/m0/s1 |
| InChIKey | XGNHYXVBIDACIB-KRWDZBQOSA-N |
| XLogP | 2.85 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|