C19H20O6S — CID 118337673
[(2S)-2-methylsulfonyloxy-5-oxopentyl] 4-phenylbenzoate (PubChem CID 118337673) has the molecular formula C19H20O6S and a molecular weight of 376.43 g/mol. Its IUPAC name is [(2S)-2-methylsulfonyloxy-5-oxopentyl] 4-phenylbenzoate.
| Compound Name | [(2S)-2-methylsulfonyloxy-5-oxopentyl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 118337673 |
| Molecular Formula | C19H20O6S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | [(2S)-2-methylsulfonyloxy-5-oxopentyl] 4-phenylbenzoate |
| SMILES | CS(=O)(=O)O[C@@H](CCC=O)COC(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C19H20O6S/c1-26(22,23)25-18(8-5-13-20)14-24-19(21)17-11-9-16(10-12-17)15-6-3-2-4-7-15/h2-4,6-7,9-13,18H,5,8,14H2,1H3/t18-/m0/s1 |
| InChIKey | OYALLVOGGSUOQK-SFHVURJKSA-N |
| XLogP | 2.83 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|