C39H43NO12S2 — CID 159971588
[(2S)-5-methoxyimino-2-methylsulfonyloxypentyl] 4-phenylbenzoate;[(2S)-2-methylsulfonyloxy-5-oxopentyl] 4-phenylbenzoate (PubChem CID 159971588) has the molecular formula C39H43NO12S2 and a molecular weight of 781.90 g/mol. Its IUPAC name is [(2S)-5-methoxyimino-2-methylsulfonyloxypentyl] 4-phenylbenzoate;[(2S)-2-methylsulfonyloxy-5-oxopentyl] 4-phenylbenzoate.
| Compound Name | [(2S)-5-methoxyimino-2-methylsulfonyloxypentyl] 4-phenylbenzoate;[(2S)-2-methylsulfonyloxy-5-oxopentyl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 159971588 |
| Molecular Formula | C39H43NO12S2 |
| Molecular Weight | 781.90 g/mol |
| Exact Mass | 781.22 |
| IUPAC Name | [(2S)-5-methoxyimino-2-methylsulfonyloxypentyl] 4-phenylbenzoate;[(2S)-2-methylsulfonyloxy-5-oxopentyl] 4-phenylbenzoate |
| SMILES | CON=CCC[C@@H](COC(=O)c1ccc(-c2ccccc2)cc1)OS(C)(=O)=O.CS(=O)(=O)O[C@@H](CCC=O)COC(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H23NO6S.C19H20O6S/c1-25-21-14-6-9-19(27-28(2,23)24)15-26-20(22)18-12-10-17(11-13-18)16-7-4-3-5-8-16;1-26(22,23)25-18(8-5-13-20)14-24-19(21)17-11-9-16(10-12-17)15-6-3-2-4-7-15/h3-5,7-8,10-14,19H,6,9,15H2,1-2H3;2-4,6-7,9-13,18H,5,8,14H2,1H3/t19-;18-/m00/s1 |
| InChIKey | OEPPRSJCWVRVGO-ZXNOKPTOSA-N |
| XLogP | 6.10 |
| TPSA | 178.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.90 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|