C26H22Cl3NO8S — CID 118108794
[(2R,3S,5E)-3-benzoyloxy-5-methoxyimino-2-(2,4,5-trichlorophenyl)sulfonyloxypentyl] benzoate (PubChem CID 118108794) has the molecular formula C26H22Cl3NO8S and a molecular weight of 614.89 g/mol. Its IUPAC name is [(2R,3S,5E)-3-benzoyloxy-5-methoxyimino-2-(2,4,5-trichlorophenyl)sulfonyloxypentyl] benzoate.
| Compound Name | [(2R,3S,5E)-3-benzoyloxy-5-methoxyimino-2-(2,4,5-trichlorophenyl)sulfonyloxypentyl] benzoate |
|---|---|
| PubChem CID | 118108794 |
| Molecular Formula | C26H22Cl3NO8S |
| Molecular Weight | 614.89 g/mol |
| Exact Mass | 613.01 |
| IUPAC Name | [(2R,3S,5E)-3-benzoyloxy-5-methoxyimino-2-(2,4,5-trichlorophenyl)sulfonyloxypentyl] benzoate |
| SMILES | CO/N=C/C[C@H](OC(=O)c1ccccc1)[C@@H](COC(=O)c1ccccc1)OS(=O)(=O)c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C26H22Cl3NO8S/c1-35-30-13-12-22(37-26(32)18-10-6-3-7-11-18)23(16-36-25(31)17-8-4-2-5-9-17)38-39(33,34)24-15-20(28)19(27)14-21(24)29/h2-11,13-15,22-23H,12,16H2,1H3/b30-13+/t22-,23+/m0/s1 |
| InChIKey | HXACBZKFJWXPAD-PBTCXNHZSA-N |
| XLogP | 5.83 |
| TPSA | 117.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.89 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|