C34H28O9 — CID 139094575
[(2S,3R)-2,3,6-tribenzoyloxy-5-oxohexyl] benzoate (PubChem CID 139094575) has the molecular formula C34H28O9 and a molecular weight of 580.59 g/mol. Its IUPAC name is [(2S,3R)-2,3,6-tribenzoyloxy-5-oxohexyl] benzoate.
| Compound Name | [(2S,3R)-2,3,6-tribenzoyloxy-5-oxohexyl] benzoate |
|---|---|
| PubChem CID | 139094575 |
| Molecular Formula | C34H28O9 |
| Molecular Weight | 580.59 g/mol |
| Exact Mass | 580.17 |
| IUPAC Name | [(2S,3R)-2,3,6-tribenzoyloxy-5-oxohexyl] benzoate |
| SMILES | O=C(COC(=O)c1ccccc1)C[C@@H](OC(=O)c1ccccc1)[C@H](COC(=O)c1ccccc1)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C34H28O9/c35-28(22-40-31(36)24-13-5-1-6-14-24)21-29(42-33(38)26-17-9-3-10-18-26)30(43-34(39)27-19-11-4-12-20-27)23-41-32(37)25-15-7-2-8-16-25/h1-20,29-30H,21-23H2/t29-,30+/m1/s1 |
| InChIKey | WPDAQEGEWYMOAD-IHLOFXLRSA-N |
| XLogP | 5.11 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.59 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|