C24H34O6Si2 — CID 67190343
[(2R,3R)-4-benzoyloxy-2,3-bis(trimethylsilyloxy)butyl] benzoate (PubChem CID 67190343) has the molecular formula C24H34O6Si2 and a molecular weight of 474.70 g/mol. Its IUPAC name is [(2R,3R)-4-benzoyloxy-2,3-bis(trimethylsilyloxy)butyl] benzoate.
| Compound Name | [(2R,3R)-4-benzoyloxy-2,3-bis(trimethylsilyloxy)butyl] benzoate |
|---|---|
| PubChem CID | 67190343 |
| Molecular Formula | C24H34O6Si2 |
| Molecular Weight | 474.70 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | [(2R,3R)-4-benzoyloxy-2,3-bis(trimethylsilyloxy)butyl] benzoate |
| SMILES | C[Si](C)(C)O[C@H](COC(=O)c1ccccc1)[C@@H](COC(=O)c1ccccc1)O[Si](C)(C)C |
| InChI | InChI=1S/C24H34O6Si2/c1-31(2,3)29-21(17-27-23(25)19-13-9-7-10-14-19)22(30-32(4,5)6)18-28-24(26)20-15-11-8-12-16-20/h7-16,21-22H,17-18H2,1-6H3/t21-,22-/m1/s1 |
| InChIKey | WCYIJNYPGAFRAM-FGZHOGPDSA-N |
| XLogP | 5.14 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.70 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|