C20H22O8 — CID 14018806
[(2R,3R,4R,5R)-6-benzoyloxy-2,3,4,5-tetrahydroxyhexyl] benzoate (PubChem CID 14018806) has the molecular formula C20H22O8 and a molecular weight of 390.39 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-6-benzoyloxy-2,3,4,5-tetrahydroxyhexyl] benzoate.
| Compound Name | [(2R,3R,4R,5R)-6-benzoyloxy-2,3,4,5-tetrahydroxyhexyl] benzoate |
|---|---|
| PubChem CID | 14018806 |
| Molecular Formula | C20H22O8 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | [(2R,3R,4R,5R)-6-benzoyloxy-2,3,4,5-tetrahydroxyhexyl] benzoate |
| SMILES | O=C(OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)COC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H22O8/c21-15(11-27-19(25)13-7-3-1-4-8-13)17(23)18(24)16(22)12-28-20(26)14-9-5-2-6-10-14/h1-10,15-18,21-24H,11-12H2/t15-,16-,17-,18-/m1/s1 |
| InChIKey | LDFVROHMRYBVGB-BRSBDYLESA-N |
| XLogP | 0.14 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |