C17H24F6O6 — CID 157079554
methane;[(2S,3R)-4,4,4-trifluoro-2,3-dihydroxybutyl] benzoate;(2S,3R)-1,1,1-trifluoropentane-2,3-diol (PubChem CID 157079554) has the molecular formula C17H24F6O6 and a molecular weight of 438.36 g/mol. Its IUPAC name is methane;[(2S,3R)-4,4,4-trifluoro-2,3-dihydroxybutyl] benzoate;(2S,3R)-1,1,1-trifluoropentane-2,3-diol.
| Compound Name | methane;[(2S,3R)-4,4,4-trifluoro-2,3-dihydroxybutyl] benzoate;(2S,3R)-1,1,1-trifluoropentane-2,3-diol |
|---|---|
| PubChem CID | 157079554 |
| Molecular Formula | C17H24F6O6 |
| Molecular Weight | 438.36 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | methane;[(2S,3R)-4,4,4-trifluoro-2,3-dihydroxybutyl] benzoate;(2S,3R)-1,1,1-trifluoropentane-2,3-diol |
| SMILES | C.CC[C@@H](O)[C@H](O)C(F)(F)F.O=C(OC[C@H](O)[C@@H](O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C11H11F3O4.C5H9F3O2.CH4/c12-11(13,14)9(16)8(15)6-18-10(17)7-4-2-1-3-5-7;1-2-3(9)4(10)5(6,7)8;/h1-5,8-9,15-16H,6H2;3-4,9-10H,2H2,1H3;1H4/t8-,9+;3-,4+;/m01./s1 |
| InChIKey | ADJJKQJGXNEROD-ZWWGVHASSA-N |
| XLogP | 2.44 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |