C34H30O10 — CID 162881363
[(2R,3S,4R,5S)-3,5,6-tribenzoyloxy-2,4-dihydroxyhexyl] benzoate (PubChem CID 162881363) has the molecular formula C34H30O10 and a molecular weight of 598.60 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-3,5,6-tribenzoyloxy-2,4-dihydroxyhexyl] benzoate.
| Compound Name | [(2R,3S,4R,5S)-3,5,6-tribenzoyloxy-2,4-dihydroxyhexyl] benzoate |
|---|---|
| PubChem CID | 162881363 |
| Molecular Formula | C34H30O10 |
| Molecular Weight | 598.60 g/mol |
| Exact Mass | 598.18 |
| IUPAC Name | [(2R,3S,4R,5S)-3,5,6-tribenzoyloxy-2,4-dihydroxyhexyl] benzoate |
| SMILES | O=C(OC[C@@H](O)[C@H](OC(=O)c1ccccc1)[C@H](O)[C@H](COC(=O)c1ccccc1)OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H30O10/c35-27(21-41-31(37)23-13-5-1-6-14-23)30(44-34(40)26-19-11-4-12-20-26)29(36)28(43-33(39)25-17-9-3-10-18-25)22-42-32(38)24-15-7-2-8-16-24/h1-20,27-30,35-36H,21-22H2/t27-,28+,29-,30+/m1/s1 |
| InChIKey | GGMKTBUVEXAYOW-ATIZSFMBSA-N |
| XLogP | 3.87 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.60 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|