C13H15FO6 — CID 90346841
[(2R)-4-fluoro-3-formyloxy-2,5-dihydroxypentyl] benzoate (PubChem CID 90346841) has the molecular formula C13H15FO6 and a molecular weight of 286.25 g/mol. Its IUPAC name is [(2R)-4-fluoro-3-formyloxy-2,5-dihydroxypentyl] benzoate.
| Compound Name | [(2R)-4-fluoro-3-formyloxy-2,5-dihydroxypentyl] benzoate |
|---|---|
| PubChem CID | 90346841 |
| Molecular Formula | C13H15FO6 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | [(2R)-4-fluoro-3-formyloxy-2,5-dihydroxypentyl] benzoate |
| SMILES | O=COC(C(F)CO)[C@H](O)COC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H15FO6/c14-10(6-15)12(20-8-16)11(17)7-19-13(18)9-4-2-1-3-5-9/h1-5,8,10-12,15,17H,6-7H2/t10?,11-,12?/m1/s1 |
| InChIKey | KWZAZEFVUWJKEC-MOENNCHZSA-N |
| XLogP | 0.08 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|