C19H16ClFO5 — CID 146406682
[(2S,4S)-3-benzoyloxy-2-chloro-4-fluoro-5-oxopentyl] benzoate (PubChem CID 146406682) has the molecular formula C19H16ClFO5 and a molecular weight of 378.78 g/mol. Its IUPAC name is [(2S,4S)-3-benzoyloxy-2-chloro-4-fluoro-5-oxopentyl] benzoate.
| Compound Name | [(2S,4S)-3-benzoyloxy-2-chloro-4-fluoro-5-oxopentyl] benzoate |
|---|---|
| PubChem CID | 146406682 |
| Molecular Formula | C19H16ClFO5 |
| Molecular Weight | 378.78 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | [(2S,4S)-3-benzoyloxy-2-chloro-4-fluoro-5-oxopentyl] benzoate |
| SMILES | O=C[C@@H](F)C(OC(=O)c1ccccc1)[C@@H](Cl)COC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H16ClFO5/c20-15(12-25-18(23)13-7-3-1-4-8-13)17(16(21)11-22)26-19(24)14-9-5-2-6-10-14/h1-11,15-17H,12H2/t15-,16+,17?/m0/s1 |
| InChIKey | FDEZPWPLBRQMBM-RTKIROINSA-N |
| XLogP | 3.21 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.78 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|