C27H24O6 — CID 139697958
[(2R)-2,4-dibenzoyloxyhex-5-enyl] benzoate (PubChem CID 139697958) has the molecular formula C27H24O6 and a molecular weight of 444.48 g/mol. Its IUPAC name is [(2R)-2,4-dibenzoyloxyhex-5-enyl] benzoate.
| Compound Name | [(2R)-2,4-dibenzoyloxyhex-5-enyl] benzoate |
|---|---|
| PubChem CID | 139697958 |
| Molecular Formula | C27H24O6 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | [(2R)-2,4-dibenzoyloxyhex-5-enyl] benzoate |
| SMILES | C=CC(C[C@H](COC(=O)c1ccccc1)OC(=O)c1ccccc1)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H24O6/c1-2-23(32-26(29)21-14-8-4-9-15-21)18-24(33-27(30)22-16-10-5-11-17-22)19-31-25(28)20-12-6-3-7-13-20/h2-17,23-24H,1,18-19H2/t23?,24-/m1/s1 |
| InChIKey | UDSQZBYVZDRLPJ-XMMISQBUSA-N |
| XLogP | 4.87 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|