C16H20O7 — CID 20598918
[(2R,4S)-4,5-diacetyloxy-2-hydroxypentyl] benzoate (PubChem CID 20598918) has the molecular formula C16H20O7 and a molecular weight of 324.33 g/mol. Its IUPAC name is [(2R,4S)-4,5-diacetyloxy-2-hydroxypentyl] benzoate.
| Compound Name | [(2R,4S)-4,5-diacetyloxy-2-hydroxypentyl] benzoate |
|---|---|
| PubChem CID | 20598918 |
| Molecular Formula | C16H20O7 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | [(2R,4S)-4,5-diacetyloxy-2-hydroxypentyl] benzoate |
| SMILES | CC(=O)OC[C@H](C[C@@H](O)COC(=O)c1ccccc1)OC(C)=O |
| InChI | InChI=1S/C16H20O7/c1-11(17)21-10-15(23-12(2)18)8-14(19)9-22-16(20)13-6-4-3-5-7-13/h3-7,14-15,19H,8-10H2,1-2H3/t14-,15+/m1/s1 |
| InChIKey | IPXMLYAHNFSUNX-CABCVRRESA-N |
| XLogP | 1.09 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|