C23H15F5O4 — CID 92836325
[(2S)-2-benzoyloxy-3-(2,3,4,5,6-pentafluorophenyl)propyl] benzoate (PubChem CID 92836325) has the molecular formula C23H15F5O4 and a molecular weight of 450.36 g/mol. Its IUPAC name is [(2S)-2-benzoyloxy-3-(2,3,4,5,6-pentafluorophenyl)propyl] benzoate.
| Compound Name | [(2S)-2-benzoyloxy-3-(2,3,4,5,6-pentafluorophenyl)propyl] benzoate |
|---|---|
| PubChem CID | 92836325 |
| Molecular Formula | C23H15F5O4 |
| Molecular Weight | 450.36 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | [(2S)-2-benzoyloxy-3-(2,3,4,5,6-pentafluorophenyl)propyl] benzoate |
| SMILES | O=C(OC[C@H](Cc1c(F)c(F)c(F)c(F)c1F)OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H15F5O4/c24-17-16(18(25)20(27)21(28)19(17)26)11-15(32-23(30)14-9-5-2-6-10-14)12-31-22(29)13-7-3-1-4-8-13/h1-10,15H,11-12H2/t15-/m0/s1 |
| InChIKey | OYKKKNCEFRMVFL-HNNXBMFYSA-N |
| XLogP | 5.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.36 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|