C27H17Cl3O9 — CID 102069502
2,3-bis[(4-carbonochloridoylbenzoyl)oxy]propyl 4-carbonochloridoylbenzoate (PubChem CID 102069502) has the molecular formula C27H17Cl3O9 and a molecular weight of 591.78 g/mol. Its IUPAC name is 2,3-bis[(4-carbonochloridoylbenzoyl)oxy]propyl 4-carbonochloridoylbenzoate.
| Compound Name | 2,3-bis[(4-carbonochloridoylbenzoyl)oxy]propyl 4-carbonochloridoylbenzoate |
|---|---|
| PubChem CID | 102069502 |
| Molecular Formula | C27H17Cl3O9 |
| Molecular Weight | 591.78 g/mol |
| Exact Mass | 589.99 |
| IUPAC Name | 2,3-bis[(4-carbonochloridoylbenzoyl)oxy]propyl 4-carbonochloridoylbenzoate |
| SMILES | O=C(Cl)c1ccc(C(=O)OCC(COC(=O)c2ccc(C(=O)Cl)cc2)OC(=O)c2ccc(C(=O)Cl)cc2)cc1 |
| InChI | InChI=1S/C27H17Cl3O9/c28-22(31)15-1-7-18(8-2-15)25(34)37-13-21(39-27(36)20-11-5-17(6-12-20)24(30)33)14-38-26(35)19-9-3-16(4-10-19)23(29)32/h1-12,21H,13-14H2 |
| InChIKey | SXHULVUCDSMQSM-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.78 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|