C45H32Cl6O9 — CID 11445948
2,3-bis[(3,5-dichloro-4-phenylmethoxybenzoyl)oxy]propyl 3,5-dichloro-4-phenylmethoxybenzoate (PubChem CID 11445948) has the molecular formula C45H32Cl6O9 and a molecular weight of 929.46 g/mol. Its IUPAC name is 2,3-bis[(3,5-dichloro-4-phenylmethoxybenzoyl)oxy]propyl 3,5-dichloro-4-phenylmethoxybenzoate.
| Compound Name | 2,3-bis[(3,5-dichloro-4-phenylmethoxybenzoyl)oxy]propyl 3,5-dichloro-4-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 11445948 |
| Molecular Formula | C45H32Cl6O9 |
| Molecular Weight | 929.46 g/mol |
| Exact Mass | 926.02 |
| IUPAC Name | 2,3-bis[(3,5-dichloro-4-phenylmethoxybenzoyl)oxy]propyl 3,5-dichloro-4-phenylmethoxybenzoate |
| SMILES | O=C(OCC(COC(=O)c1cc(Cl)c(OCc2ccccc2)c(Cl)c1)OC(=O)c1cc(Cl)c(OCc2ccccc2)c(Cl)c1)c1cc(Cl)c(OCc2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C45H32Cl6O9/c46-34-16-30(17-35(47)40(34)55-22-27-10-4-1-5-11-27)43(52)58-25-33(60-45(54)32-20-38(50)42(39(51)21-32)57-24-29-14-8-3-9-15-29)26-59-44(53)31-18-36(48)41(37(49)19-31)56-23-28-12-6-2-7-13-28/h1-21,33H,22-26H2 |
| InChIKey | XKUSHDVSXZTHCO-UHFFFAOYSA-N |
| XLogP | 12.58 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 929.46 |
| LogP ≤ 5 | 12.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|