C13H11BCl2O3 — CID 4197353
(3,5-dichloro-4-phenylmethoxyphenyl)boronic acid (PubChem CID 4197353) has the molecular formula C13H11BCl2O3 and a molecular weight of 296.95 g/mol. Its IUPAC name is (3,5-dichloro-4-phenylmethoxyphenyl)boronic acid.
| Compound Name | (3,5-dichloro-4-phenylmethoxyphenyl)boronic acid |
|---|---|
| PubChem CID | 4197353 |
| Molecular Formula | C13H11BCl2O3 |
| Molecular Weight | 296.95 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | (3,5-dichloro-4-phenylmethoxyphenyl)boronic acid |
| SMILES | OB(O)c1cc(Cl)c(OCc2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C13H11BCl2O3/c15-11-6-10(14(17)18)7-12(16)13(11)19-8-9-4-2-1-3-5-9/h1-7,17-18H,8H2 |
| InChIKey | BAXPPGSWZDNMOG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.95 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|