C15H16BClO3 — CID 63456607
[3-[(4-chloro-2,6-dimethylphenoxy)methyl]phenyl]boronic acid (PubChem CID 63456607) has the molecular formula C15H16BClO3 and a molecular weight of 290.56 g/mol. Its IUPAC name is [3-[(4-chloro-2,6-dimethylphenoxy)methyl]phenyl]boronic acid.
| Compound Name | [3-[(4-chloro-2,6-dimethylphenoxy)methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 63456607 |
| Molecular Formula | C15H16BClO3 |
| Molecular Weight | 290.56 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | [3-[(4-chloro-2,6-dimethylphenoxy)methyl]phenyl]boronic acid |
| SMILES | Cc1cc(Cl)cc(C)c1OCc1cccc(B(O)O)c1 |
| InChI | InChI=1S/C15H16BClO3/c1-10-6-14(17)7-11(2)15(10)20-9-12-4-3-5-13(8-12)16(18)19/h3-8,18-19H,9H2,1-2H3 |
| InChIKey | ZGCPXMWCJHOJIW-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.56 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|