C19H14Cl2O2 — CID 54314779
3,5-dichloro-4-[(4-phenylphenyl)methoxy]phenol (PubChem CID 54314779) has the molecular formula C19H14Cl2O2 and a molecular weight of 345.23 g/mol. Its IUPAC name is 3,5-dichloro-4-[(4-phenylphenyl)methoxy]phenol.
| Compound Name | 3,5-dichloro-4-[(4-phenylphenyl)methoxy]phenol |
|---|---|
| PubChem CID | 54314779 |
| Molecular Formula | C19H14Cl2O2 |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | 3,5-dichloro-4-[(4-phenylphenyl)methoxy]phenol |
| SMILES | Oc1cc(Cl)c(OCc2ccc(-c3ccccc3)cc2)c(Cl)c1 |
| InChI | InChI=1S/C19H14Cl2O2/c20-17-10-16(22)11-18(21)19(17)23-12-13-6-8-15(9-7-13)14-4-2-1-3-5-14/h1-11,22H,12H2 |
| InChIKey | SNKGNRRDPJEMNM-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |