C13H8Cl4O2 — CID 54127176
3,5-dichloro-4-[(3,4-dichlorophenyl)methoxy]phenol (PubChem CID 54127176) has the molecular formula C13H8Cl4O2 and a molecular weight of 338.02 g/mol. Its IUPAC name is 3,5-dichloro-4-[(3,4-dichlorophenyl)methoxy]phenol.
| Compound Name | 3,5-dichloro-4-[(3,4-dichlorophenyl)methoxy]phenol |
|---|---|
| PubChem CID | 54127176 |
| Molecular Formula | C13H8Cl4O2 |
| Molecular Weight | 338.02 g/mol |
| Exact Mass | 335.93 |
| IUPAC Name | 3,5-dichloro-4-[(3,4-dichlorophenyl)methoxy]phenol |
| SMILES | Oc1cc(Cl)c(OCc2ccc(Cl)c(Cl)c2)c(Cl)c1 |
| InChI | InChI=1S/C13H8Cl4O2/c14-9-2-1-7(3-10(9)15)6-19-13-11(16)4-8(18)5-12(13)17/h1-5,18H,6H2 |
| InChIKey | NRUGELUWDHERPM-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.02 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |