C7H6Cl2O2 — CID 166873402
1,2-dichloro-4-(hydroperoxymethyl)benzene (PubChem CID 166873402) has the molecular formula C7H6Cl2O2 and a molecular weight of 193.03 g/mol. Its IUPAC name is 1,2-dichloro-4-(hydroperoxymethyl)benzene.
| Compound Name | 1,2-dichloro-4-(hydroperoxymethyl)benzene |
|---|---|
| PubChem CID | 166873402 |
| Molecular Formula | C7H6Cl2O2 |
| Molecular Weight | 193.03 g/mol |
| Exact Mass | 191.97 |
| IUPAC Name | 1,2-dichloro-4-(hydroperoxymethyl)benzene |
| SMILES | OOCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C7H6Cl2O2/c8-6-2-1-5(4-11-10)3-7(6)9/h1-3,10H,4H2 |
| InChIKey | CLLQVNCBCFKPLH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.03 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|