C19H13Cl3O3 — CID 54082853
3,5-dichloro-4-[(4-chloro-3-phenoxyphenyl)methoxy]phenol (PubChem CID 54082853) has the molecular formula C19H13Cl3O3 and a molecular weight of 395.67 g/mol. Its IUPAC name is 3,5-dichloro-4-[(4-chloro-3-phenoxyphenyl)methoxy]phenol.
| Compound Name | 3,5-dichloro-4-[(4-chloro-3-phenoxyphenyl)methoxy]phenol |
|---|---|
| PubChem CID | 54082853 |
| Molecular Formula | C19H13Cl3O3 |
| Molecular Weight | 395.67 g/mol |
| Exact Mass | 393.99 |
| IUPAC Name | 3,5-dichloro-4-[(4-chloro-3-phenoxyphenyl)methoxy]phenol |
| SMILES | Oc1cc(Cl)c(OCc2ccc(Cl)c(Oc3ccccc3)c2)c(Cl)c1 |
| InChI | InChI=1S/C19H13Cl3O3/c20-15-7-6-12(8-18(15)25-14-4-2-1-3-5-14)11-24-19-16(21)9-13(23)10-17(19)22/h1-10,23H,11H2 |
| InChIKey | MOILCQNVPDWSEP-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.67 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |