About CID 88829366
CID 88829366 (PubChem CID 88829366) has the molecular formula C28H20AlCl2O7
and a molecular weight of 566.35 g/mol.
Molecular Properties
| Compound Name | CID 88829366 |
| PubChem CID | 88829366 |
| Molecular Formula | C28H20AlCl2O7 |
| Molecular Weight | 566.35 g/mol |
| Exact Mass | 565.04 |
| IUPAC Name | — |
| SMILES | O=C(Cc1ccc(Cl)c(Oc2ccccc2)c1)OOOC(=O)Cc1ccc(Cl)c(Oc2ccccc2)c1.[Al] |
| InChI | InChI=1S/C28H20Cl2O7.Al/c29-23-13-11-19(15-25(23)33-21-7-3-1-4-8-21)17-27(31)35-37-36-28(32)18-20-12-14-24(30)26(16-20)34-22-9-5-2-6-10-22;/h1-16H,17-18H2; |
| InChIKey | NBJPZWBRKJEKMY-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 566.35 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze CID 88829366 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88829366?
The IUPAC name of CID 88829366 (CID 88829366) is not available.
What is the SMILES notation for CID 88829366?
The canonical SMILES for CID 88829366 is O=C(Cc1ccc(Cl)c(Oc2ccccc2)c1)OOOC(=O)Cc1ccc(Cl)c(Oc2ccccc2)c1.[Al].
What is the InChIKey of CID 88829366?
The InChIKey is NBJPZWBRKJEKMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H20Cl2O7.Al/c29-23-13-11-19(15-25(23)33-21-7-3-1-4-8-21)17-27(31)35-37-36-28(32)18-20-12-14-24(30)26(16-20)34-22-9-5-2-6-10-22;/h1-16H,17-18H2;.
What are the key properties of CID 88829366?
CID 88829366 has a molecular weight of 566.35 g/mol, XLogP of 6.92, 10 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88829366 is sourced from PubChem (CID 88829366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).