C16H16Cl2O2 — CID 97179315
[2-[(3,4-dichlorophenyl)methoxy]-3,4-dimethylphenyl]methanol (PubChem CID 97179315) has the molecular formula C16H16Cl2O2 and a molecular weight of 311.21 g/mol. Its IUPAC name is [2-[(3,4-dichlorophenyl)methoxy]-3,4-dimethylphenyl]methanol.
| Compound Name | [2-[(3,4-dichlorophenyl)methoxy]-3,4-dimethylphenyl]methanol |
|---|---|
| PubChem CID | 97179315 |
| Molecular Formula | C16H16Cl2O2 |
| Molecular Weight | 311.21 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | [2-[(3,4-dichlorophenyl)methoxy]-3,4-dimethylphenyl]methanol |
| SMILES | Cc1ccc(CO)c(OCc2ccc(Cl)c(Cl)c2)c1C |
| InChI | InChI=1S/C16H16Cl2O2/c1-10-3-5-13(8-19)16(11(10)2)20-9-12-4-6-14(17)15(18)7-12/h3-7,19H,8-9H2,1-2H3 |
| InChIKey | WBGSGBRSKNFRJP-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.21 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |