C15H13Cl2IO3 — CID 1319055
[4-[(3,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methanol (PubChem CID 1319055) has the molecular formula C15H13Cl2IO3 and a molecular weight of 439.08 g/mol. Its IUPAC name is [4-[(3,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methanol.
| Compound Name | [4-[(3,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methanol |
|---|---|
| PubChem CID | 1319055 |
| Molecular Formula | C15H13Cl2IO3 |
| Molecular Weight | 439.08 g/mol |
| Exact Mass | 437.93 |
| IUPAC Name | [4-[(3,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methanol |
| SMILES | COc1cc(CO)cc(I)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H13Cl2IO3/c1-20-14-6-10(7-19)5-13(18)15(14)21-8-9-2-3-11(16)12(17)4-9/h2-6,19H,7-8H2,1H3 |
| InChIKey | AMZXCZQOFJKIDP-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.08 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|