C24H25ClO5 — CID 5245459
[3-chloro-4-[(3-ethoxy-4-phenylmethoxyphenyl)methoxy]-5-methoxyphenyl]methanol (PubChem CID 5245459) has the molecular formula C24H25ClO5 and a molecular weight of 428.91 g/mol. Its IUPAC name is [3-chloro-4-[(3-ethoxy-4-phenylmethoxyphenyl)methoxy]-5-methoxyphenyl]methanol.
| Compound Name | [3-chloro-4-[(3-ethoxy-4-phenylmethoxyphenyl)methoxy]-5-methoxyphenyl]methanol |
|---|---|
| PubChem CID | 5245459 |
| Molecular Formula | C24H25ClO5 |
| Molecular Weight | 428.91 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | [3-chloro-4-[(3-ethoxy-4-phenylmethoxyphenyl)methoxy]-5-methoxyphenyl]methanol |
| SMILES | CCOc1cc(COc2c(Cl)cc(CO)cc2OC)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C24H25ClO5/c1-3-28-22-12-18(9-10-21(22)29-15-17-7-5-4-6-8-17)16-30-24-20(25)11-19(14-26)13-23(24)27-2/h4-13,26H,3,14-16H2,1-2H3 |
| InChIKey | IUKKBHFJGFPLRO-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.91 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |